|
Новости Статьи Рецензии Ивенты Форум | |||
|
Регистрация | Правила форума | Сообщество | Календарь | Новые релизы (RSS) | Новые темы | Сообщения за день | Поиск |
In General Жанры, стили, лейблы, сборники, радиостанции, зины, дистро, блоги - все о музыке. Также - вопросы, касающиеся обустройства музыкальной части форума |
Опции темы | Поиск в этой теме |
03.03.2007, 12:18 | #1 |
Punk rocker
Репутация: 28
|
Punk rock FTP
ftp://kindkid.ihome.ua ftp://81.95.186.101
впринципе вся коллекция Kiev Punk rock Elite собрана в одном месте на UA-IX. Спасибо Ване за то что держит сервер практически 24/7. Всё что вы хотели знать о панк роке, но не знали где взять. Там конечно не всё что у нас есть, но, довольно большая часть. Практически все релизы со сцены. Что бы я рекомендовал для ознакомления впервую очередь - 2Fast4u 30 Foot Fall 12 Cents 88 Fingers Louie Aditive Alkaline Trio (ранний) Balzac Beefcake Beerbong Belvedere Bigwig Blind Pigs Bouncing Souls Choking Victim Damn Sunday Drivers Diesel Boy Dogwood Down By Law Face To Face Five Iron Frenzy Formula One Frenzal Rhomb Fury 66 Good Riddance короче, я заебался, качайте, там есть практически всё. Само собой Lagwagon/Strung Out/No Use For A Name/, это в первую очередь. По каждой группе - полная дискография. Всё пиздатого качества, отбиралось в течении хуй знает скольки лет на сраном дайл апе, и сегодня вы все имеете возможность ознакомится с тем, что представляет собой мировая панк рок сцена. Опять-таки в силу того что там действительно огромнейший объём музыки и видео, можете спрашивать, задавать вопросы - будем рекомендовать по возможности. На этом же фтп также масса японской музыки ( не мазафаки) там лежит видео последнего лайва X Japan, хотя для истинных фанатов могу переписать этот лайв на 2 двухслойных двд - качество - припиздатейшее. Если интересует что-то чего там нет - маякуйте, выложим или запишем. Хотя в силу определённых обстоятельств и полного отсутствия времени писать мне очень в облом =) Код:
|-- mp3 | | |-- 1 Mai 87 | | |-- 1,5 | | |-- 1.6 Band | | |-- 10 After | | |-- 10.15 Saturday Night | | |-- 100 Demons | | |-- 100 Flowers | | |-- 100 Scheisse | | |-- 1000 Legger | | |-- 1000 Travels of Jawaharlal | | |-- 1000 Yard Stare | | |-- 10000 Hurts | | |-- 101ers | | |-- 108 | | |-- 11 Minutes Away | | |-- 1125 | | |-- 12 Cents a Shot | | |-- 12 Cents for Marvin | | |-- 12 Ottavi | | |-- 12 Pack Pretty | | |-- 1208 | | |-- 1295 | | |-- 12cent | | |-- 13 Deep | | |-- 13 PFP | | |-- 1313 Muckingbird Lane | | |-- 13th Draft | | |-- 13th Floor Elevators | | |-- 13th Tribe | | |-- 14 Year Old Girls | | |-- 15 Minutes Late | | |-- 16 | | |-- 17 Years | | |-- 175R | | |-- 17th Class | | |-- 1905 | | |-- 1982 | | |-- 1999 | | |-- 19th Hole | | |-- 2 0 Clock Girlfriend | | |-- 2 Minutos | | |-- 2 Samoleta | | |-- 20 Inch Long | | |-- 20 Years Old | | |-- 200 North | | |-- 200 Sachen | | |-- 2000 Maniacs | | |-- 2002-A Life Once Lost | | |-- 2020 | | |-- 21lLcks | | |-- 22 Jacks | | |-- 22 Pistepirkko | | |-- 24 Hour Taco Shop | | |-- 24H Hell | | |-- 25 Ta Life | | |-- 27 Gioda | | |-- 27 | | |-- 28 Days Straight | | |-- 28 Days | | |-- 2Fast4U | | |-- 2nd Best | | |-- 2nd Society | | |-- 2-Pump Louie | | |-- 2sleepy | | |-- 3 Colours Red | | |-- 3 Day Benda | | |-- 3 Days Later | | |-- 3 Feet Smaller | | |-- 3 Flaschen Inna Plastiktuete | | |-- 3 Sestry | | |-- 3 Stage | | |-- 3 Way Cum | | |-- 30 Amp Fuse | | |-- 30 Day Warranty | | |-- 30 Foot Fall | | |-- 30 Seconds Over Tokyo | | |-- 30 Seconds to Mars | | |-- 30 Seconds Until Armageddon | | |-- 30 Years War | | |-- 31 Knots | | |-- 324 | | |-- 32FramesPerSecond | | |-- 33 West | | |-- 365 Days In A Week | | |-- 37 Hostias | | |-- 37 Stabwoundz | | |-- 3D House of Beef | | |-- 3d | | |-- 3DBS Down | | |-- 3rd Degree | | |-- 3TimesTree | | |-- 4 Be 2 | | |-- 4 Belle Bambine | | |-- 4 In The Chamber | | |-- 4 Promille | | |-- 4 Skins | | |-- 40 Watt Domain | | |-- 400 Blows | | |-- 400 Suits | | |-- 41 Gorgeous Blocks | | |-- 426 | | |-- 46 Short | | |-- 47 Dead | | |-- 4fit | | |-- 4ft Fingers | | |-- 4teen Killers | | |-- 5 Bugs | | |-- 5 Cent Deposit | | |-- 5 Days Ahead | | |-- 5 Good Reasons | | |-- 5 Knuckle Chuckle | | |-- 50 Caliber | | |-- 500 Miles To Memphis | | |-- 500ML | | |-- 504 Plan | | |-- 5150 | | |-- 52 Metro | | |-- 52 Minutes | | |-- 55cheese | | |-- 57 Shifty | | |-- 58 Skivies | | |-- 59 Times The Pain | | |-- 6 Foot Landing | | |-- 6 Voltios | | |-- 62 Pennies | | |-- 63 High | | |-- 65 Filmshow | | |-- 666 Aniolow | | |-- 667 | | |-- 69 Charger | | |-- 6-DTC | | |-- 6th Avenue | | |-- 7 and 7 Is | | |-- 7 Angels 7 Plagues | | |-- 7 Magnificoz | | |-- 7 Minds | | |-- 7 Note in Nero | | |-- 7 Seconds | | |-- 7 Times Suicide | | |-- 7 Year Bitch | | |-- 7 Years Bad Luck | | |-- 7 Years | | |-- 720 | | |-- 8 6 Crew | | |-- 8 Bark | | |-- 8 Bit Revival | | |-- 8 Count | | |-- 88 Fingers Louie | | |-- 8th Grade | | |-- 8th Wave | | |-- 9 Shocks Terror | | |-- 90 Day Men | | |-- 93 Million Miles From The Sun | | |-- 97a | | |-- 98 Mute | | |-- 995 | | |-- 999 | | |-- 99anger | | |-- 9mm | | |-- A And P | | |-- A Bit of Braindead | | |-- A Bitch Called Hope | | |-- A Blinding Silence | | |-- A Buck Short | | |-- A Chorus Of Disapproval | | |-- A Common Ground | | |-- A Day in Black and White | | |-- A Day To Fall | | |-- A Day To Remember | | |-- A Days Refrian | | |-- A Dead Giveaway | | |-- A Death For Every Sin | | |-- A Destructive Issue | | |-- A Drop Dead Star | | |-- A Dying Daydream | | |-- A Failed Escape | | |-- A Global Threat | | |-- A Hero Next Door | | |-- A Long Winter | | |-- A Loss For Words | | |-- A Luna Red | | |-- A Minor Forest | | |-- A Modern Safari | | |-- A New Beginning | | |-- A New Enemy | | |-- A New Kind Of American Saint | | |-- A Perfect Circle | | |-- A Poor Excuse | | |-- A Radio With Guts | | |-- A Room With A View | | |-- A Shroud Cast Over | | |-- A Silver Mount Zion | | |-- A Small Victory | | |-- A Sometimes Promise | | |-- A Static Lullaby | | |-- A Storybook Ending | | |-- A String Quartet | | |-- A Traitor Like Judas | | |-- A Week In July | | |-- A Whisper In The Noise | | |-- A Wilhelm Scream | | |-- A.C.K | | |-- A.C.T | | |-- A.G.E | | |-- A.K.A | | |-- A.O.A | | |-- A | | |-- A18 | | |-- A200club | | |-- A77aque | | |-- AAARGH | | |-- Aandp | | |-- Aarktica | | |-- Aaron Spiro | | |-- Aaronin | | |-- ABADDON | | |-- Abalienation | | |-- ABC Diablo | | |-- Abcs | | |-- Abdera | | |-- Abductors | | |-- Abduktio | | |-- Abe Froman | | |-- Aberdien | | |-- Abfallsozialprodukt | | |-- Abfluss | | |-- Abhinanda | | |-- Abi Yoyos | | |-- Abnegation | | |-- Aborted | | |-- Abraham Cross | | |-- Abraham | | |-- Abrasive Wheels | | |-- Abraxas | | |-- Absent Without Leave | | |-- Absidia | | |-- Absolom | | |-- Absolution | | |-- Abstain | | |-- Abstuerzende Brieftauben | | |-- Absurd Attitude | | |-- Abuse | | |-- Abusive Action | | |-- Abuso Sonoro | | |-- Abyss | | |-- ACAB | | |-- Academy Morticians | | |-- Acao Direta | | |-- Acceptance | | |-- Accident Prone | | |-- Accion Mutante | | |-- Accursed [UK] | | |-- Accursed | | |-- Accustomed To Nothing | | |-- Ace Troubleshooter | | |-- Achilles | | |-- Acid | | |-- Ack | | |-- Ackerbau Und Viehzucht | | |-- Aclys | | |-- Acme | | |-- Acolderyear | | |-- Acredine | | |-- Acrophet | | |-- Across Five Aprils | | |-- Across The Border | | |-- Act Your Age | | |-- Action 69 | | |-- Action Action | | |-- Action Pact | | |-- Action Patrol | | |-- Action | | |-- Actionmen | | |-- Active Ingrediants | | |-- Active Minds | | |-- Actives | | |-- Actos Fallidos | | |-- Acursed | | |-- Acusticos E Valvulados | | |-- Acute | | |-- Ad Nauseam | | |-- Adair | | |-- Adam And The Ants | | |-- Adam Green | | |-- Adam Sandler | | |-- Adamantium | | |-- Adara | | |-- Add Renaline | | |-- Addiction | | |-- Adequate Seven | | |-- Adhesive | | |-- Adicts | | |-- Adios | | |-- Aditive | | |-- Adjudgement | | |-- Adjusted | | |-- Adjustments | | |-- Admiral James | | |-- Admiral | | |-- Adolescents | | |-- Adolf And The Piss Artists | | |-- Adrenalin O.D | | |-- Adverts | | |-- Affront | | |-- AFI | | |-- AFO | | |-- Afraid Of Sheep | | |-- Africa Unite | | |-- After All | | |-- After Project | | |-- After School Special | | |-- Afterschool Special | | |-- Against All Authority | | |-- Against Me! | | |-- Agent 99 | | |-- Agent Felix | | |-- Agnostic Front | | |-- Aiden | | |-- Air Sheep Charlie | | |-- Air Show Disaster | | |-- Akurat | | |-- Alarmrock | | |-- Alaska (Quebec) | | |-- Alaska | | |-- Alcoholic White Trash | | |-- Alexisonfire | | |-- Alien Ant Farm | | |-- Alien Crime Syndicate | | |-- Alien's Cab | | |-- Alkaline Trio | | |-- All Bets Off | | |-- All Else Failed | | |-- All Else Fails | | |-- All Heroes Die | | |-- All My Heroes | | |-- All Out War | | |-- All Smiles | | |-- All Time Low | | |-- All Under Age | | |-- All | | |-- Allergic To Bullshit | | |-- Alli With An I | | |-- Allister | | |-- Almost Always | | |-- Aloha | | |-- Alter Bridge | | |-- Amanda Rogers | | |-- Amanda Woodward | | |-- Amazing Transparent Man | | |-- Amber Pacific | | |-- Amberglow | | |-- Amen. The Animal | | |-- American Hi-Fi | | |-- American Nightmare | | |-- American Steel | | |-- Amity | | |-- Amoeba | | |-- Amoklauf | | |-- An Angle | | |-- Anadivine | | |-- Anal Cunt | | |-- Anal Thunder | | |-- Anchors Away | | |-- Anchors For Arms | | |-- And Faster We Fall | | |-- And None of Them Knew They Were Robots | | |-- And Now We're Even | | |-- And Their Eyes Were Bloodshot | | |-- And You Will Know Us By The Trail Of Dead | | |-- Andrew W.K | | |-- Angel City Outcasts | | |-- Angelic Upstarts | | |-- Angels And Airwaves | | |-- Animals Killing People | | |-- Ann Beretta | | |-- Annuals | | |-- Anola's Recovery | | |-- Anonymous Souls | | |-- Anterrabae | | |-- Anti-Anti | | |-- Anti-Clockwise | | |-- Antidote | | |-- Anti-Flag | | |-- Antiseen | | |-- A-OK | | |-- A--Political | | |-- Appendix | | |-- April Fool's Day | | |-- AqME | | |-- Architects | | |-- Arctic Monkeys | | |-- Area 7 | | |-- Argue Damnation | | |-- Arkham | | |-- Arlington View | | |-- Armageddon Sky | | |-- Armatage Shanks | | |-- Armchair Martian | | |-- Armed Suspects | | |-- Armia | | |-- Army Of Anyone | | |-- Army of Freshmen | | |-- Arraya | | |-- ASG | | |-- Ashwin | | |-- Asian Kung-Fu Generation | | |-- Aside | | |-- Asleep | | |-- Asphix | | |-- Aspo | | |-- Ass Bandit | | |-- Assault | | |-- Assfort | | |-- Asshole parade | | |-- Assorted Jelly Beans | | |-- Asta Kask | | |-- Asuca Hayashi | | |-- At All Cost | | |-- At Dusk | | |-- At The Drive-In | | |-- Atari Teenage Riot | | |-- Atavistic | | |-- A-Team | | |-- Athlete | | |-- Atom and His Package | | |-- Attack In Black | | |-- Attaque 77 | | |-- Attila the Stockbroker | | |-- Audible | | |-- Audio Karate | | |-- August Burns Red | | |-- Authority Zero | | |-- Autistic Youth | | |-- Automatic 7 | | |-- Autopilot Off | | |-- Avail | | |-- Avenged Sevenfold | | |-- Awesome Color | | |-- Awesome Snakes | | |-- Babylove & The Van Dangos | | |-- Backstage | | |-- Bad Astronaut | | |-- Bad Blood | | |-- Bad Brains | | |-- Bad Day Dawn | | |-- Bad Lieutenants | | |-- Bad Manners | | |-- Bad Religion | | |-- Bakers Dozen | | |-- Balla Tounkara | | |-- Balzac | | |-- Banana Gang | | |-- Band Of Horses | | |-- Bandits of the Acoustic Revolution | | |-- Bane | | |-- Barnacle Bill | | |-- Barracuda | | |-- Barracudas | | |-- Barricade | | |-- Bastard | | |-- Bayside | | |-- BBQ Chickens | | |-- Beans | | |-- Bear Garden | | |-- Bear vs Shark | | |-- Beat Crusaders | | |-- Becoming The Archetype | | |-- Beefcake | | |-- Beerbong | | |-- Beercan | | |-- Before The Dawn | | |-- Bela B | | |-- Beloved | | |-- Belvedere | | |-- Ben Weasel | | |-- Benuts | | |-- BER-LINN | | |-- Best Kept Secret | | |-- Beth In Battle Mode | | |-- Betrayed | | |-- Better Luck Next Time | | |-- Better Than A Thousand | | |-- Between Home And Serenity | | |-- Beulah | | |-- Beyond a Grey Skye | | |-- Beyond All Reason | | |-- Beyond Reasonable Doubt | | |-- Big Blue Monkey | | |-- Big D and The Kids Table | | |-- Big Drill Car | | |-- Bigwig | | |-- Bikini Kill | | |-- Billy Talent | | |-- Bitch | | |-- Black Fag | | |-- Black Fire | | |-- Black Flag | | |-- Black Sunday | | |-- Black Tie Bombers | | |-- Black Time | | |-- Blacklisted | | |-- Blade Loki | | |-- Blank Promise | | |-- Blanks 77 | | |-- Blatant | | |-- Bleach | | |-- Bleeding Through | | |-- Blind Pigs | | |-- Blinded Black | | |-- Blindside | | |-- Blink-182 | | |-- Blisterhead | | |-- Blitzkid | | |-- Blixtlaas | | |-- Bloc Party | | |-- Blonde Redhead | | |-- Blood Brothers | | |-- Blount | | |-- Blowsight | | |-- Blue Collar Special | | |-- Blue Meanies | | |-- Blue Star Highway | | |-- Blue Stingrays | | |-- Blue Suede Bombers | | |-- Bob Burns And The Breakups | | |-- Bob's Kitchen | | |-- Body Bag | | |-- Bodyjar | | |-- Bombs Over Providence | | |-- Bombshell Rocks | | |-- Bones Brigade | | |-- Bora | | |-- Borg 64 | | |-- Born Against | | |-- Born to Lose | | |-- Bottom Line | | |-- Bouncing Souls | | |-- Bowling For Soup | | |-- Box Car Racer | | |-- Boxcar Satan | | |-- Boxcar | | |-- Boxing Fox | | |-- Boy Kicks Girl | | |-- Boy Sets Fire | | |-- Boy's Life | | |-- Boys Night Out | | |-- Bracket | | |-- Brahman | | |-- Braid | | |-- Brand New Disaster | | |-- Brand New | | |-- Brandtson | | |-- Bravo Fucking Bravo | | |-- Brett Bixby | | |-- Bridge To Solace | | |-- Bright Eyes | | |-- Bring Your Own Weapon | | |-- Broadway Calls | | |-- Broadways Not Ready | | |-- Brodie | | |-- Brody | | |-- Brookside | | |-- Brutal Knights | | |-- Brutally Frank | | |-- Buck Wild | | |-- Buck-O-Nine | | |-- Buckwild | | |-- Buddy Holly | | |-- Building Rome | | |-- Bukkake Katholik | | |-- Bullet Train To Vegas | | |-- Bullet Treatment | | |-- Burgworth | | |-- Burning Heads | | |-- Burnt By The Sun | | |-- Burnthe8track | | |-- Bush | | |-- Busted | | |-- Buzzcocks | | |-- ByAllMeans | | |-- C.Aarme | | |-- Caitline | | |-- Calico System | | |-- Capital | | |-- Captain Chaos | | |-- Captain Everything! | | |-- Capture The Flag | | |-- Carbona | | |-- Carlisle | | |-- Carpathian | | |-- Cash In | | |-- Catch 22 | | |-- Catherine | | |-- Cauterize | | |-- Cenzura | | |-- CF98 | | |-- Chad VanGaalen | | |-- Champion | | |-- Chariots | | |-- Charta 77 | | |-- Chase Long Beach | | |-- Cheap Sex | | |-- Cheap Trick | | |-- Chelsea | | |-- Chickenpox | | |-- Chillerton | | |-- Chiodos | | |-- Chixdiggit! | | |-- Choking Victim | | |-- Christ On Parade | | |-- Cigar | | |-- Cipher | | |-- Circle Of Death | | |-- Circus Act | | |-- Citizen Fish | | |-- Cky | | |-- Clit 45 | | |-- Clusterfuxx | | |-- Cobra Skulls | | |-- Cobra Starship | | |-- Cobra | | |-- Coca Carola | | |-- Cock Sparrer | | |-- Coconut | | |-- Codename Rocky | | |-- Coheed and Cambria | | |-- Coldplay | | |-- Colera | | |-- Colonopenbracket | | |-- Colored Rice Men | | |-- Coma Lies | | |-- Comeback Kid | | |-- Common Rider | | |-- Communique | | |-- Commuter | | |-- Conclusion | | |-- Confuse | | |-- Consider The Meek | | |-- Consumed | | |-- Cool Hand Luke | | |-- Coparck | | |-- Coquettish | | |-- Cortez | | |-- Counterpunch | | |-- Counting Crows | | |-- Countless Shadows | | |-- Covet The Knife | | |-- CPC Gangbangs | | |-- CPM 22 | | |-- Crackout | | |-- Craig's Brother | | |-- Crazy Rocket Surfers | | |-- Crime In Stereo | | |-- Criminal Damage | | |-- Cross Examination | | |-- Curse of Instinct | | |-- Cursive | | |-- Cut My Skin | | |-- D.R.I | | |-- Dag Nasty | | |-- Daggermouth | | |-- Damn Sunday Drivers | | |-- Damnation | | |-- Dan Padilla | | |-- Dance Gavin Dance | | |-- Dance Hall Crashes | | |-- Dance of Days | | |-- Darkest Hour | | |-- Darwin | | |-- Dashboard Confessional | | |-- Dave Melillo | | |-- David & the Citizens | | |-- Days Like These | | |-- DC Fallout | | |-- Dead By Gun | | |-- Dead City Shakers | | |-- Dead Fish | | |-- Dead Fucking Last | | |-- Dead Kennedys | | |-- Dead Mechanical | | |-- Dead Poetic | | |-- Dead To Me | | |-- Deadline | | |-- Deadly Snakes | | |-- Deadwood | | |-- Dear and the Headlights | | |-- Dear Tonight | | |-- Deas Vail | | |-- Death By Stereo | | |-- Death Cab For Cutie | | |-- Death of a Party | | |-- Death To Your King | | |-- Decapitated | | |-- Default | | |-- Defiance | | |-- Delaware | | |-- Delay | | |-- Delorean | | |-- Delsondrive | | |-- Desaparecidos | | |-- Descendents | | |-- Desmond Dekker | | |-- Despised | | |-- Despondent | | |-- Destructors 666 | | |-- Deviates | | |-- Devotchkas | | |-- Dia Psalma | | |-- Dickies | | |-- Diction | | |-- Die Blumentopferde | | |-- Die Die Die | | |-- Die Hunns | | |-- Die Out! | | |-- Die Trying | | |-- Die You Bastard! | | |-- Diecast | | |-- Diesel Boy | | |-- Dillinger Four | | |-- Dimi Dero Inc | | |-- Dinosaur Jr | | |-- Dir En Grey | | |-- Dirty Kings | | |-- Discharge | | |-- Disconvenience | | |-- Disrespect | | |-- Distemper | | |-- District | | |-- Divit | | |-- DMONSTRATIONS | | |-- Dockside Hookers | | |-- Dog Day | | |-- Dog Fashion Disco | | |-- Dogpiss | | |-- Dogwood | | |-- Donnas | | |-- Donots | | |-- Dork | | |-- Down By Law | | |-- Down My Throat | | |-- Down To Earth Approach | | |-- Downstate | | |-- Downtown Singapore | | |-- Dr. Acula | | |-- Dr.Green | | |-- Dragonforce | | |-- Dreamstate | | |-- Dredg | | |-- Drone | | |-- Drop Dead Gorgeous | | |-- Dropkick Murphys | | |-- Dropout Year | | |-- Drunk By Six | | |-- Drunken Boat | | |-- Dry Kill Logic | | |-- Duffs | | |-- Dumbster | | |-- Dumpster Pop | | |-- Dustin Kensrue | | |-- Dwarves | | |-- Dynamite Boy | | |-- East West Blast Test | | |-- Eastern Youth | | |-- Easyway | | |-- Eat This Mckinley! | | |-- Egnish | | |-- Eighteen Visions | | |-- EKUK | | |-- Elakelaiset | | |-- Electric Willow | | |-- Element Eighty | | |-- Eleventh He Reaches London | | |-- Eleventyseven | | |-- Elijah | | |-- Elphaba | | |-- Embrace | | |-- Emery | | |-- Emil Bulls | | |-- Emocapella | | |-- End Of A Year | | |-- Endor | | |-- English Dogs | | |-- Epoxies | | |-- Estates | | |-- Esther Bertram | | |-- Esthetic Education | | |-- ETA | | |-- Eterna Inocencia | | |-- Etsaiak | | |-- Ever We Fall | | |-- Evergreen Terrace | | |-- Every Time I Die | | |-- Exit Evangeline | | |-- Eyeless | | |-- Eyes Catch Fire | | |-- F...etc | | |-- Fabrica Civil | | |-- Fabulous Disaster | | |-- Face It | | |-- Face Of Reality | | |-- Face To Face | | |-- Facing New York | | |-- Fahnenflucht | | |-- Fair To Midland | | |-- Fairweather | | |-- Fakeknife | | |-- Faker | | |-- Faktion | | |-- Fall Of Transition | | |-- Fall River | | |-- False Alarm | | |-- Far from Finished | | |-- Fastball | | |-- Fastlane | | |-- FBS | | |-- Feeling Left Out | | |-- Fellsilent | | |-- Fenix TX | | |-- Fifteen | | |-- Fifth Hour Hero | | |-- Fighter Hayabusa | | |-- Fightstar | | |-- Filthy White Trash | | |-- Final Conflict | | |-- Fingerbang | | |-- Fingers Cut Megamachine | | |-- Firescape | | |-- First Alliance | | |-- Fish Karma | | |-- Fishbone | | |-- Fistt | | |-- Five Iron Frenzy | | |-- Five Shot | | |-- Five Star Loser | | |-- Fivemiledrive | | |-- Flaming Cocks | | |-- Flash Grenade | | |-- Flashlight Brown | | |-- Flippin Beans | | |-- Flogging Molly | | |-- Flood Of Red | | |-- F-Minus | | |-- Folder | | |-- Folly | | |-- Fool the World | | |-- Foolish Things | | |-- For The Mathematics | | |-- Forever Is Forgotten | | |-- Forgotten Rebels | | |-- Formula One | | |-- Forty Winks | | |-- Forward | | |-- Foxy Shazam! | | |-- Francesco | | |-- Frank Turner | | |-- Franky Lee | | |-- Freakends | | |-- Free for All | | |-- Freefall | | |-- Frei.Wild | | |-- French Kicks | | |-- Frenzal Rhomb | | |-- Freygolo | | |-- Frigits | | |-- Frog Eyes | | |-- From A Second Story Window | | |-- From Autumn To Ashes | | |-- From First to Last | | |-- From The Shallows | | |-- From Zero | | |-- Frontkick | | |-- Fu Manchu | | |-- Fuck Me Dead | | |-- Fuck U Is My Name | | |-- Fuckboyz | | |-- Fucked Up | | |-- Fugazi | | |-- Fumble | | |-- Funeral Diner | | |-- Funeral For A Friend | | |-- Fury 66 | | |-- Future Of Forestry | | |-- Fy Fan | | |-- Gackt | | |-- Gauze | | |-- Gazoonga Attack | | |-- Gelugugu | | |-- Glassjaw | | |-- Go Drowsy | | |-- Gogol Bordello | | |-- Goin Places | | |-- Golden Goose | | |-- Goldenboy | | |-- Goldfinger | | |-- Good Charlotte | | |-- Good Clean Fun | | |-- Good Riddance | | |-- Goodbye Tomorrow | | |-- Gordon Ganos Army | | |-- Gorilla Biscuits | | |-- Got No Shame | | |-- Gouka | | |-- Grandaddy | | |-- Greater Than B | | |-- Green Day | | |-- Greg Graffin | | |-- Griswalds | | |-- G-TUK | | |-- Guff | | |-- Guillemots | | |-- Guitar Wolf | | |-- Guns n Wankers | | |-- Guttermouth | | |-- Gym Class Heroes | | |-- H20 | | |-- Halfwayhome | | |-- Halifax | | |-- Hallo Kwitten | | |-- Hammer Bros | | |-- Hand Me Down Buick | | |-- Hangin'out | | |-- Hanson Brothers | | |-- Hard-Ons | | |-- Harries '89 | | |-- Hate Is Just A Feeling | | |-- Hateful Monday | | |-- Havana-Club | | |-- Hawk Nelson | | |-- Heartbreak Stereo | | |-- Heartless Bastards | | |-- Heather Hates You | | |-- Heideroosjes | | |-- Hellfire Sox | | |-- Hepburn | | |-- HeyMike | | |-- Hi Standard | | |-- Hidden Sorrow | | |-- HIGH and MIGHTY COLOR | | |-- High School Football Heroes | | |-- Hills Have Eyes | | |-- Hit The Lights | | |-- Hitman | | |-- Hollywood Suicide | | |-- Home Grown | | |-- Homemade Knives | | |-- Honor Bright | | |-- Hoods | | |-- Hope | | |-- Hopes High | | |-- Hopesfall | | |-- Horace Pinker | | |-- Horse The Band | | |-- Hot Rod Circuit | | |-- Hot Water Music | | |-- House Of Fools | | |-- Huge Rat Attacks | | |-- Humble Beginnings | | |-- Huntingtons | | |-- I Adapt | | |-- I Farm | | |-- I Killed The Prom Queen | | |-- I Love Poland | | |-- I Object | | |-- I908 | | |-- Ice Nine | | |-- Idiot Pilot | | |-- Idle Kids | | |-- If All Else Fails | | |-- Iggy Pop | | |-- Ignite | | |-- IllScarlett | | |-- Imitation Electric Piano | | |-- In Flight Radio | | |-- In Stereo | | |-- In Theory | | |-- Indian Jewelry | | |-- INDK | | |-- Inhale Exhale | | |-- Inspection 12 | | |-- Instil | | |-- Insurgent Kid | | |-- Internationals | | |-- Isabelles Gift | | |-- Isadora | | |-- Isa e Buried Memorial | | |-- Japanther | | |-- Jaula de grillos | | |-- 01. The Locos - La Ultima Valla.mp3 | | |-- 02. The Locos - Paletovision.mp3 | | |-- 03. The Locos - Prepotencia Mundial.mp3 | | |-- 04. The Locos - Algo Mejor.mp3 | | |-- 05. The Locos - Madre Tierra.mp3 | | |-- Jawbreaker | | |-- Jazzbo | | |-- JeFF $ | | |-- Jersey | | |-- Jesse James | | |-- Jet Market | | |-- JFA | | |-- Jimmy Eat World | | |-- Joey Cape and Tony Sly | | |-- Joey Ramone | | |-- John Frusciante | | |-- Johnnieboy | | |-- Johnny Thunders & The Heartbreakers | | |-- Jon McLaughlin | | |-- Jucifer | | |-- Juliette and the Licks | | |-- Junction 18 | | |-- Junior | | |-- Jupiter Jones | | |-- Kakkahata'77 | | |-- Kalashnikov | | |-- Kapitan Da | | |-- Keane | | |-- Kemuri | | |-- Kevin Goes 2 College | | |-- Kid Down | | |-- Kid Dynamite | | |-- Kill The Drive | | |-- Kill Your Idols | | |-- Killed by the Bull | | |-- King Khan & The Shrines | | |-- Kings of Nuthin | | |-- Kingston Air Force | | |-- Knugen Faller | | |-- Kommunen | | |-- Kris Roe | | |-- KTP | | |-- Kylahullut | | |-- La Ghenga | | |-- Labor Force | | |-- Lagwagon | | |-- Lakeview Drive | | |-- Lampshade | | |-- L'arc~en~Ciel | | |-- Lars Frederiksen And The Bastards | | |-- Last Bullet | | |-- Last Conservative | | |-- Last Days Of April | | |-- Last November | | |-- Last Of The Believers | | |-- Latterman | | |-- Layaway Plan | | |-- Le Braghe Corte | | |-- Leftover Crack | | |-- Legitimate Business | | |-- Leiana | | |-- Les Calcatoggios | | |-- Les Marmottes Aplaties | | |-- Les Prostiputes | | |-- Less Than Jake | | |-- Letter Kills | | |-- Letters From The Front | | |-- Lidia Stone | | |-- Lightyear | | |-- Limbeck | | |-- Link 80 | | |-- Little Man Tate | | |-- Local H | | |-- Locofrank | | |-- Long Since Forgotten | | |-- Longway | | |-- Los Fastidios | | |-- Los Pericos | | |-- Loser Life | | |-- Lost Ocean | | |-- Love Equals Death | | |-- Love Lost But Not Forgotten | | |-- Lovedrug | | |-- Lower Class Brats | | |-- Lucky Boys Confusion | | |-- Lucky Stiffs | | |-- Luna | | |-- Lunatics | | |-- Lydia | | |-- Mach Pelican | | |-- Mad Band | | |-- Mad Caddies | | |-- Madelyn | | |-- Madina Lake | | |-- Mahogany | | |-- Makeshift3 | | |-- Male Factors | | |-- Manchester Orchestra | | |-- Maow | | |-- Marcel et son orchestre | | |-- Mark Lind | | |-- Marky Ramone | | |-- Matchbox 20 | | |-- Matt Pond PA | | |-- Maxeen | | |-- MC Lars | | |-- McRackins | | |-- Me First And The Gimme Gimmes | | |-- Melt Banana | | |-- Mephiskapheles | | |-- MEST | | |-- Mewithoutyou | | |-- Middle Class Trash | | |-- Midnight Creeps | | |-- Milburn | | |-- Millencolin | | |-- Mimikry | | |-- Minority Justice League | | |-- Minus The Bear | | |-- Misery Signals | | |-- Misfits | | |-- Missile Girl Scoot | | |-- Missing 23rd | | |-- Modest Mouse | | |-- Monikers | | |-- Monster | | |-- Monstrous | | |-- Morley | | |-- Morning For The Masses | | |-- Morning Glory | | |-- Motion City Soundtrack | | |-- Motorhead | | |-- Mourningstar | | |-- Mr. Irish Bastard | | |-- M-Sixteen | | |-- Mu330 | | |-- Much The Same | | |-- Muff | | |-- Mulligan Stu | | |-- Murder By Death | | |-- Murderers Row | | |-- Mustard Plug | | |-- Mute | | |-- Mutiny | | |-- MxPx | | |-- My Brightest Diamond | | |-- My Chemical Romance | | |-- My Hero Is Me | | |-- My Vitriol | | |-- Nada Surf | | |-- Nakanomori Band | | |-- Nature Living | | |-- Need For Treatment | | |-- Nekromantix | | |-- Nerf Heder | | |-- Never Heard Of It | | |-- Nevrotic Explosion | | |-- New Atlantic | | |-- New Bomb Turks | | |-- New Fist | | |-- New Found Glory | | |-- New Mexican Disaster Squad | | |-- New York Dolls | | |-- Next To Red | | |-- Nguru | | |-- N-H-K ni Yokoso Outro Theme | | |-- Nicotine | | |-- Nitad | | |-- NM50 | | |-- No Comply | | |-- No Fun at All | | |-- No Harm Done | | |-- No Hope For The Kids | | |-- No Mayers 50 | | |-- No Respect | | |-- No Risk | | |-- No Trigger | | |-- No Use For A Name | | |-- NOFX | | |-- NoMeansNo | | |-- None More Black | | |-- North | | |-- Northern Room | | |-- Not Long After | | |-- Nothington | | |-- Numbers On Napkins | | |-- O.Torvald | | |-- O.Torvald-demo.[2006].rar | | |-- Oc Toons | | |-- October Fall | | |-- Officer Kicks | | |-- Oh Juliet | | |-- Oi Polloi | | |-- Oil | | |-- OK Go | | |-- Okkervil River | | |-- Omissa | | |-- On 2 Leg | | |-- One Dollar Short | | |-- One Fine Day | | |-- One Man Army | | |-- Only Crime | | |-- Operation Ivy | | |-- dave.jpg | | |-- Discography Readme.nfo | | |-- jesse.jpg | | |-- lint.jpg | | |-- matt.jpg | | |-- Orange | | |-- Orchid | | |-- Osaka Popstar | | |-- OST | | |-- Soundtrac_kLock_Stock_and_Two_Smoking_Bar... | | |-- Our American Cousin | | |-- Out Of Date | | |-- Out_Of_Date-Fuckin_fuckin_prestinaio.mp3 | | |-- Out_Of_Date-My_certainty.mp3 | | |-- Out of Sight | | |-- Over It | | |-- Owen | | |-- P.O. Box | | |-- Panic! At The Disco | | |-- Paper Moon | | |-- Passenger Action | | |-- Pennywise | | |-- Perkele | | |-- Pg.99 | | |-- Phinius Gage | | |-- Piano | | |-- Piebald | | |-- Pierce The Veil | | |-- Pilot Scott Tracy | | |-- Pinback | | |-- Pink Razors | | |-- Pisschrist | | |-- Pistol Grip | | |-- Placebo | | |-- Please Inform The Captain This Is A Hijack | | |-- Pleasure Forever | | |-- Plus44 | | |-- Poison The Well | | |-- Portugu s Suave | | |-- Potshot | | |-- Pranksters | | |-- President Fetch | | |-- Pressure Point | | |-- Propagandhi | | |-- Protest the Hero | | |-- PROZAC | | |-- PROZAC - Track 01.mp3 | | |-- PROZAC - Track 02.mp3 | | |-- Pulley | | |-- Pulling Teeth | | |-- Punchbuggy | | |-- Punchline | | |-- Question Marks | | |-- Rabauken | | |-- Rabies | | |-- Raised Fist | | |-- Ramones | | |-- Rancid | | |-- Random55 | | |-- Randy | | |-- Ratos de Porao | | |-- Razors Edge | | |-- Rebelation | | |-- Red Hot Chili Peppers | | |-- Reel Big Fish | | |-- Refused | | |-- Reggie And The Full Effect | | |-- Reign Supreme | | |-- Relax | | |-- Relentless | | |-- Relient K | | |-- Remote Confederation | | |-- Rent A Life | | |-- Rentokill | | |-- Reset | | |-- Revolution Mother | | |-- Rhythmic Coughing | | |-- Rich Kids On LSD | | |-- Riddlin Kids | | |-- Ringers | | |-- Rise Against | | |-- River City High | | |-- Riverdales | | |-- Rivers Cuomo | | |-- Robot Eyes | | |-- Robots Dont Cry | | |-- Robots Talk In Twos | | |-- Rocky Votolato | | |-- Rookie of the Year | | |-- Rotterdam SKA-Jazz Foundation | | |-- Round Three Fight | | |-- Royseven | | |-- Rubber City Rebels | | |-- Rufio | | |-- Run Like Hell | | |-- Rutabaga Suicide | | |-- Rx Bandits | | |-- Ryan's Hope | | |-- Sad Boy Sinister | | |-- Sadaharu | | |-- Sadies Doll | | |-- Satanic Surfers | | |-- Saunawest | | |-- Save Ferris | | |-- Say When | | |-- Scrapy | | |-- Screeching Weasel | | |-- Screw 32 | | |-- Seaweed | | |-- Secondhand Serenade | | |-- Select Five | | |-- Set Your Goals | | |-- Seven Story Fall | | |-- Severed | | |-- Sex Pistols | | |-- Sexy | | |-- Shade | | |-- Sham 69 | | |-- Shane MacGowan and the Popes | | |-- Shark Attack | | |-- She Likes Todd | | |-- Sherwood | | |-- Shitake Monkey | | |-- Shoemaker Levy 9 | | |-- Shootki | | |-- Sick City Daggers | | |-- Sick Of Change | | |-- Sick Of It All | | |-- Signal Hill Transmission | | |-- Signal Home | | |-- Signal Lost | | |-- Sikth | | |-- Silverstein | | |-- Simple Plan | | |-- SKA ringspil | | |-- Bolest.mp3 | | |-- Dignitas.mp3 | | |-- Gde sam to ja.mp3 | | |-- I hate you so.mp3 | | |-- Molder.mp3 | | |-- Ska Ska Club | | |-- Skafield | | |-- Skafish | | |-- Skaladdin | | |-- Skalariak | | |-- Skalatones | | |-- Ska-P | | |-- Skarmy of Darkness | | |-- Ska-Wars | | |-- Skeletons And The King Of Al | | |-- Skint | | |-- Skumdum | | |-- Skylab Hoax | | |-- Slapstick | | |-- Sleeping At Last | | |-- Sleeping Weather | | |-- Slick Shoes | | |-- Slide Show Baby | | |-- Small Brown Bike | | |-- Small Leaks Sink Ships | | |-- Smoke Or Fire | | |-- Snail Ramp | | |-- SNFU | | |-- Snuff | | |-- Social Distortion | | |-- Solar Powered People | | |-- Some Girls | | |-- Someone Still Loves You Boris Yeltsin | | |-- Something In Portuguese | | |-- Sonic Boom Six | | |-- Sorry About Dresden | | |-- Sorry About The Catfight | | |-- Sounds Like Chicken | | |-- Space Cadet Steve | | |-- Spare Lead | | |-- Spitfire | | |-- SPLITS | | |-- Spoiler NYC | | |-- Spread | | |-- Squad Five-O | | |-- Square9 | | |-- Squirtgun | | |-- St. Petersburg Ska-Jazz Review | | |-- Stack44 | | |-- Stance Punks | | |-- Standing Still | | |-- Staring Back | | |-- Stars Are Falling | | |-- Stars Fall Like Tears | | |-- 01-Drowning Myself in Tears.mp3 | | |-- 02-Your Shadow Is Close Behind.mp3 | | |-- 03-Breathe For me.mp3 | | |-- 04-So Let Me Die.mp3 | | |-- 05-Promises And Hearts.mp3 | | |-- Start From Scratch | | |-- Steakknife | | |-- Still Remains | | |-- StinX | | |-- Stone Sour | | |-- Story of the Year | | |-- Stowaway | | |-- Straightaway | | |-- Stranger On A Train | | |-- Streetlight Manifesto | | |-- Stressface | | |-- Strike Anywhere | | |-- Striking Distance | | |-- Stroke 9 | | |-- Strung Out | | |-- Stutterfly | | |-- Stza | | |-- Subb | | |-- Sublime | | |-- Submission Hold | | |-- Suburban Legends | | |-- Suburban Studs | | |-- Sugarcult | | |-- Sum 41 | | |-- Sundowner | | |-- Sunn 0))) | | |-- Sunny Day Real Estate | | |-- Sunny Domestozs | | |-- Sunset West | | |-- Super Black Market | | |-- Superbus | | |-- Sweet Baby | | |-- Swingin' Utters | | |-- Switches | | |-- System and Station | | |-- Taking Back Sunday | | |-- Taking On The World | | |-- Talking Heads | | |-- Tastes Like Chicken | | |-- Team Stray | | |-- Teen Idols | | |-- Teenage Bottlerocket | | |-- Teenage Harlets | | |-- Ten Foot Pole | | |-- Tenacious D | | |-- Terror Town High | | |-- Test Icicles | | |-- Testicals | | |-- The '89 Cubs | | |-- The Actual | | |-- The Aggrolites | | |-- The Album Leaf | | |-- The All-American Rejects | | |-- The Almost | | |-- The Apples In Stereo | | |-- The Aquabats | | |-- The Arrivals | | |-- The Arrogant Sons Of Bitches | | |-- The Assassinators | | |-- The Ataris | | |-- The Automatic | | |-- The Bandgeek Mafia | | |-- The Basement | | |-- The Bayonets | | |-- The Bear Quartet | | |-- The Bishops | | |-- The Black List | | |-- The Blacklist Royals | | |-- The Blinds | | |-- The Bloody Irish Boys | | |-- The Boils | | |-- The Bonus Army | | |-- The Boss | | |-- The Bouncing Souls | | |-- The Brakes | | |-- The Bravery | | |-- The Breakup | | |-- The Breeders | | |-- The Cardinal Sin | | |-- The Casualties | | |-- The Changes | | |-- The Chariot | | |-- The Cheats | | |-- The Classic Brown | | |-- The Code | | |-- The Colour | | |-- The Comas | | |-- The Copyrights | | |-- The Crack Whore Society | | |-- The Cure | | |-- The Czars | | |-- The Damned | | |-- The Dangerous Summer | | |-- The Dear Hunter | | |-- The Death of Anna Karina | | |-- The Decemberists | | |-- The Destroyed | | |-- The Devil Wears Prada | | |-- The Dickies | | |-- The Dimwits | | |-- The Disappointments | | |-- The Distillers | | |-- The Draft | | |-- The Ducky Boys | | |-- The Dykeenies | | |-- The Early November | | |-- The Eat | | |-- The Embraced | | |-- The Ergs | | |-- The Escalators | | |-- The Expos | | |-- The Exposed | | |-- The Extraordinaires | | |-- The Falcon | | |-- The Fiction | | |-- The Flaming Lips | | |-- The Flatliners | | |-- The Fold | | |-- The Follow | | |-- The Futureheads | | |-- The Gadjits | | |-- The Gazette | | |-- The Generators | | |-- The Get Up Kids | | |-- The Ghost Is Dancing | | |-- The Gibbons | | |-- The Go! Team | | |-- The Good, The Bad & The Queen | | |-- The Gossip | | |-- The Gothic Archies | | |-- The Graduation Day | | |-- The Great Depression | | |-- The Green Peanuts | | |-- The Grit | | |-- The Groovie Ghoulies | | |-- The Hatepinks | | |-- The Heartbreak Motel | | |-- The Heights | | |-- The Hero Dies | | |-- The Hero Factor | | |-- The Heroines | | |-- The High Court | | |-- The Higher | | |-- The Hippos | | |-- The Hives | | |-- The Hoodies | | |-- The Hunt For Yoshi | | |-- The Isles | | |-- The Junior Varsity | | |-- The Juvies | | |-- The Killers | | |-- The Killigans | | |-- The Killing Tree | | |-- The Kind That Kills | | |-- The King Blues | | |-- The KissCut | | |-- The Knob | | |-- The Know How | | |-- The Kooks | | |-- The Last Car In Alaska | | |-- The Lawrence Arms | | |-- The Legion Of Doom | | |-- The Leif Ericsson | | |-- The Lillingtons | | |-- The Liptones | | |-- The Living End | | |-- The Locust | | |-- The Loved Ones | | |-- The Low Budgets | | |-- The Luninol | | |-- The Maccabees | | |-- The Mad Capsule Markets | | |-- The Magic Numbers | | |-- The Manges | | |-- The Manhattan Love Suicides | | |-- The Marked Men | | |-- The Marshes | | |-- The Matches | | |-- The Measure (SA) | | |-- The Members | | |-- The Menzingers | | |-- The Meteors | | |-- The Methadones | | |-- The Miracle | | |-- The Monsters | | |-- The Morning Light | | |-- The Morning Of | | |-- The Myriad | | |-- The Nation Blue | | |-- The New Amsterdams | | |-- The Offspring | | |-- The Orangeburg Massacre | | |-- The Ordinary Boys | | |-- The Orphans | | |-- The Palookas | | |-- The Peacocks | | |-- The Photo Atlas | | |-- The Pietasters | | |-- The Pigeon Detectives | | |-- The Plants | | |-- The Plus Nomination | | |-- The Priceduifkes | | |-- The Prize Fighter Inferno | | |-- The Queers | | |-- The Rakes | | |-- The Rapture | | |-- The Reason | | |-- The Red Jumpsuit Apparatus | | |-- The Revision | | |-- The Ripps | | |-- The Riptides | | |-- The Roosters | | |-- The Sainte Catherines | | |-- The Salads | | |-- The Scourge Of The Sea | | |-- The Secret Show | | |-- The Shins | | |-- The Sinks | | |-- The Skatalites | | |-- The Slits | | |-- The Smears | | |-- The Snake The Cross The Crown | | |-- The Sophmore Attempt | | |-- The Sound Of Animals Fighting | | |-- The Sounds | | |-- The Soviettes | | |-- The Spacepimps | | |-- The Special Guests | | |-- The Specials | | |-- The Speeds | | |-- The Spoilers | | |-- The Spookshow | | |-- The Spotlight | | |-- The Staggers | | |-- The Stairs | | |-- The State Street Liars | | |-- The Steinways | | |-- The Stooges | | |-- The String Quartet | | |-- The Strokes | | |-- The Subhumans | | |-- The Subways | | |-- The Suicide Machines | | |-- The Swellers | | |-- The Thermals | | |-- The Toasters | | |-- The Tossers | | |-- The Touchers | | |-- The Triffids | | |-- The Turbo A.C.s | | |-- The Twinkles | | |-- The Underdogs | | |-- The Unseen | | |-- The Used | | |-- The Valentines | | |-- The Vandals | | |-- The Veils | | |-- The Victory Year | | |-- The View | | |-- The Village Green | | |-- The Vines | | |-- The Walkmen | | |-- The Wanderers | | |-- The Whitest Boy Alive | | |-- The Who | | |-- The Wish You Weres | | |-- The Year Zero | | |-- The Young Knives | | |-- The Zincs | | |-- Thee Flanders | | |-- Theyweregunshots | | |-- Thirteen Senses | | |-- This Day & Age | | |-- This Time Next Year | | |-- Through the Ashes | | |-- Thursday | | |-- Tied For Last | | |-- Tiger Army | | |-- Tim Armstrong | | |-- Time Again | | |-- Tokyo Ska Paradise Orchestra | | |-- Too Late The Hero | | |-- Total Chaos | | |-- Total Egon & Dennis & Dom Bl Apelsinerna | | |-- Tower Blocks | | |-- Toy Dolls | | |-- Toys That Kill | | |-- Trail Of Dead | | |-- Transplants | | |-- Tranzmitors | | |-- Traste Och Superstararna | | |-- Tri-Lambda | | |-- Tripdash | | |-- Triple Clutch | | |-- Triple Threat | | |-- Trophy Scars | | |-- Turbostaat | | |-- Twenty2 | | |-- Two Gallants | | |-- Two if by Sea | | |-- U.S. Bombs | | |-- UKKO | | |-- Ultima Thule | | |-- Uncommonmenfrommars | | |-- Undeclinable Ambuscade | | |-- Under Pressure | | |-- Under The Influence Of Giants | | |-- Unearth | | |-- Union 13 | | |-- Unpaid Debt | | |-- Until June | | |-- Urgency | | |-- Useless ID | | |-- VA | | |-- Vanilla Sky | | |-- Venerea | | |-- Venus Hill | | |-- Voodoo Glow Skulls | | |-- Vortex Rex | | |-- V-Punk | | |-- Vulgaires Machins | | |-- Waking Ashland | | |-- Walls Of Jericho | | |-- Waste Basket | | |-- We Are Scientists | | |-- Weak at Best | | |-- Weatherbox | | |-- Weezer | | |-- Western Addiction | | |-- Wheatus | | |-- Whiskey and Co | | |-- Whiskey Rebels | | |-- Why | | |-- Windmill | | |-- Wintch Mob | | |-- Witches With Dicks | | |-- Wizo | | |-- Wovenhand | | |-- X Is For Eyes | | |-- XFilesX | | |-- X-Japan | | |-- Xlooking ForwardX | | |-- XXL | | |-- Yakuzi | | |-- Yeah Yeah Yeahs | | |-- Yellowcard | | |-- Yesterdays Rising | | |-- Yifei | | |-- Yo La Tengo | | |-- You Apart | | |-- You, Me, And Everyone We Know | | |-- Your Black Star | | |-- Yourcodenameis-Milo | | |-- Youth of Today | | |-- Youthinasia | | |-- Yum! Yum! Orange | | |-- Zao | | |-- Zebrahead | | |-- Zeke | | |-- Zero Down | | |-- Zombie Ghost Train Последний раз редактировалось Avis; 29.12.2007 в 00:01. |
36 пользователя(ей) сказали спасибо: | andron (14.09.2008), caffeinevsnicotine (21.09.2020), cid86 (04.01.2009), Dave Beaver (16.10.2008), DC (29.12.2007), Decadance (18.04.2008), Die_die_my_darling (02.11.2007), dudi1991 (29.04.2009), Gandhi (27.09.2008), Gop_Stop (13.11.2009), Hazard (28.08.2007), hurenpimmel (16.09.2008), IgorQ.WRD (29.11.2008), immaltigor (07.12.2007), Make me believe (22.05.2009), MIRW810I (22.01.2009), Nook (09.11.2007), POGOkid (18.09.2009), PomChe (13.04.2010), q4er (26.04.2010), rage (25.01.2008), ricer (21.11.2007), Rich (18.05.2015), Scrooge (12.11.2009), Sergio (06.05.2008), stay cold (15.07.2008), Stiffler (03.06.2011), t_cr (06.12.2008), usyara (06.08.2009), vasyapunk (20.09.2009), vilnuy (26.07.2011), xShadowx (23.01.2009), ZLIK (22.06.2008), zuzya (26.05.2008), Костя (28.06.2007), фык (27.11.2008) |
20.07.2008, 09:08 | #306 |
tape
Репутация: 16
|
Re: Punk rock FTP
Alkaline_Trio-Help_Me-VLS-2008-SDR
Atlas_Losing_Grip-Shut_The_World_Out-2008-FNT cobra_kai-complete_recordings-vinyl-2002-its Four_Monstrous_Nuclear_Stockpiles-Give_Peace_A_Chance-2008-rH gantz-la_chambre_des_morts-fr-2006-hxc Henry_Fiats_Open_Sore-Mondo_Blotto-Vinyl-2008-hXc Isis-Holy_Tears_And_Not_In_Rivers_But_In_Drops-2008-hXc Isosceles-Get_Your_Hands_Off-(Promo_CDS)-2007-FUNKTiFiNO Keitzer-As_the_World_Burns-2008-rH Northern19-From_Here_To_Everywhere-2008-SGV Regal_Beagle-A_Little_Tide_Up-2008-FNT Team_Stray-Three_Songs_About_Girls_And_One_About_Trevor-(7_Inch)-2008-FNT The_Domino_Theory-Language-(EP)-2008-FNT The_Dopamines-The_Dopamines-2008-FNT The_Living_End-White_Noise-2008-EUPHORiC The_Steinways-Unoriginal_Recipe-(CDR)-2008-FNT Throw_Rag-2nd_Place-2008-pLAN9 Throw_Rag-Tee-Tot-(Reissue)-2008-pLAN9 Totalfat-Hello_And_Goodnight-(EP)-2007-SGV va-la_quiete-acrimonie-7_inch-split-2002-gf VA-La_Quiete-The_Apoplexy_Twist_Orchestra-7_Inch-Split-2003-gF VA-Lets_Go_Ghoulie-A_Tribute_To_The_Groovy_Ghoulies-2008-FNT VA-Live_At_Ricky_Genes-2008-pLAN9 VA-Methadones_and_The_Copyrights_Split-2008-pLAN9 VA-Methadones_and_The_Copyrights_Split-2008-v0 va-shikari_and_louise_cyphre-vinyl-2005 VA-Suburban_Showdown_and_Distress_Split-2008-pLAN9 |
03.08.2008, 06:21 | #307 |
tape
Репутация: 16
|
Re: Punk rock FTP
Antiseen-Best_Of-2CD-2008-RTB
Applicants-Life_In_The_Bus_Lane-2008-pLAN9 Asado-Asado-2008-FNT Beatbeat-Taco_Show-(7inch_Vinyl)-2007-rH Beatbeat-Without_You-(7inch_Vinyl)-2008-rH Born_To_Lose-Saints_Gone_Wrong-(Advance)-2008-PMS Carbonas-Euro_Tour_Ep-7Inch-Vinyl-2008-hXc Chixdiggit-Chupacabras-7_Inch_(Vinyl)-1997-iTS Deadly_Sins-Selling_Our_Weakness-(Advance)-2008-PMS Dead_Kennedys-A_Skateboard_Party-Vinyl-1983-gF Funeral_For_A_Friend-Beneath_The_Burning_Tree-(Promo_CDS)-2008-DV8 Gizzards-Chop_Off_Your_Head-2008-pLAN9 Gordon_Ganos_Army-Art_Of_The_Underground_Single_Series_Vol_22-VLS-2008-pLAN9 Henry_Fiats_Open_Sore-Mondo_Blotto-Vinyl-2008-hXc Johnny_Nightmare-Heres_Johnny-2008-gF Love_Songs-Hot_Buns-VLS-2007-pLAN9 Motorhead-Motorizer-Promo-2008-QTXMp3 Potboiler-Art_Of_The_Underground_Single_Series_Vol_14-VLS-2007-pLAN9 Rampires-Bat_Taste-2006-gF Reflected-Paradise_Found-2008-pLAN9 Regal_Beagle-A_Little_Tide_Up-2008-FNT Siouxsie_and_the_Banshees-20th_Century_Masters-The_Millennium_Collection_The_Best_of-2006-NHH Sloppy_Seconds-Endless_Bummer-2008-FNT Small_Town_Riot-Selftitled-2008-CRN Stop_Drop_N_Skank-Stop_Drop_N_Skank-EP-2008-pLAN9 Team_Robespierre-88th_Precinct-(Promo_EP)-2008-DV8 The_Adicts-Songs_Of_Praise_(25_Anniversary)-(Advance)-2008-PMS The_Copyrights-Make_Sound-2007-FIH_INT The_Domino_Theory-Language-(EP)-2008-FNT The_Dopamines-The_Dopamines-2008-FNT The_Methadones-This_Wont_Hurt-2007-FIH_INT The_Title-Making_A_Scene-2008-FNT The_Veterans-The_Veterans-2008-pLAN9 The_Youths-Generationless-7inch-Vinyl-2007-pLAN9 Turbo_Lax-Ulichnyi_Boy_-_Turbo_Lax-2006-GRW VA-Destructors_666-The_Ruined-Punky_Rebel_Media-The_Ted_Rogers_EP-(Split-EP)-2008-pLAN9 VA-One_Step_Beyond-The_Unstoppable_Rhythm_Of_Reggae_And_Ska-2008-DV8 Vultures_United-Dirt_Hearts-2008-pLAN9 |
12.08.2008, 11:16 | #309 |
tape
Репутация: 16
|
Re: Punk rock FTP
Blackout-Stop_the_Clock-2006-rH
Dorian_Gray-The_Precurse-2008-UTP Friends_Back_East-4_Song_Demo-2008-pLAN9 Gewapend_Beton-17_Until_We_Die-2008-SDR Lagwagon-I_Think_My_Older_Brother_Used_To_Listen_To_Lagwagon-(EP)-2008-pLAN9 La_Doble_A-Paraiso_AA-ES-2008-GRAVEWISH Massmord-Unleashed-2007-rH New_Lows-New_Lows-(EP)-2008-BUTT Norma_Jean-The_Anti_Mother-2008-FNT Off_With_Their_Heads-From_The_Bottom-2008-FNT Rex_Banner-The_Good_Times_Are_Killing_Me-(Reissue)-2008-AMX Slight_Slappers-Tomorrow_Will_the_Sun_Shine_Again-2006-rH The_Acacia_Strain-Continent-(Advance)-2008-FNT The_Damnsels-My_Gender_Role-(EP)-2008-404 To_The_Bones-Rex-(Promo_CDS)-2008-DV8 Two_Man_Advantage-South_Of_Canada-2008-pLAN9 VA-Banjax-Voetsek-2006-rH VA-Filftpact-Atomgevitter-Split-2007-rH VA-Suck_City_Vol._8-2CD-2008-rH We_Are_The_Union-Who_We_Are-2007-MTD With_Wings_of_Lead-The_Rising-2008-rH |
04.09.2008, 12:36 | #312 |
tape
Репутация: 16
|
Re: Punk rock FTP
Adam_West-ESP_Extra_Sexual_Perception-(Advance)-2008-PMS
Agent-I_Wouldnt_Trade_That_For_Anything-(EP)-2006-FNT Anberlin-New_Surrender-2008-KTHX Atta-I_Just_Love_to_Say_I_Called_You-2008-RUDD A_Static_Lullaby-Rattlesnake-2008-RTB Bitter_End-Bitter_End-7_Inch-Vinyl-2008-KzT chuck ragan & the loved ones - split 7'' (2008) Civet-Hell_Heath_No_Fury-2008-pLAN9 Confront-What_Have_We_Become-(EP)-2008-RTB Coue_Method-To_Mock_a_Vapid_World-2008-GRAVEWISH Cutman-No_Trick_Pony-Big_Deal-(EP)-2008-FNT Dave_Clarke-White_Noise_At_Lowlands_Festival-READ_NFO-CABLE-08-17-2008-PTC Dragonforce-Ultra_Beatdown-Promo-2008-QTXMp3 Evil_Cavies-There_Must_Be_A_Need_For_Me-2006-SDR Eye_Am-0tt0_Elite-2008-MTD Falling_Short_Of_Science-A_World_Apart-2008-RTB Fed_Up_74-What_to_Do-CDEP-2008-rH Finch-Finch-(EP)-2008-FNT Force_The_Fallen-Dont_Bet_A_Penny_On_Tomorrow-2008-RTB Hamfatter-What_Part_Of_Hamfatter_Do_You_Not_Understand-(Advance)-2008-DV8 High_Risk--Rock_Out_with_Your_Cock_Out_(Re-Rock)-CDR-2008-WUS Holy_Moses-Agony_Of_Death-Promo-2008-QTXMp3 Killing_California-Goin_South-2007-pLAN9 Killswitch_Engage-(Live_at_Lowlands-15-08-08)-x264-2008-NiF Kolporteure--Einmal_Damals_und_Zurueck-DE-2008-OMA Kondor_-_Illusion_Und_Realitaet-DE-2008-YSP Liberator-Ring_The_Alarm-EP-2008-gF Maradona-Cool_Brag-(EP)-2008-EXP McRackins-Eggzit-2008-FNT Mr._Miyagi-Were_Always_Angry-(VINYL)-2008-PMS Mute-The_Raven-2008-404 Odeath-Broken_Hymns_Limbs_And_Skin-(Advance)-2008-DV8 Off_With_Their_Heads-From_The_Bottom-2008-FNT One_Second_2_Late-World_Time_Bomb-2008-C4 Perfect_Machines-Perfect_Machines-2008-EXP Rex_Banner-Homewrecker-Split-2008-GRAVEWISH Rex_Banner-The_Good_Times_Are_Killing_Me-(Reissue)-2008-AMX Rocket_From_The_Crypt-All_Systems_Go_III-2008-KzT Rogue_Set-Shake_Those_Hands-2008-RTB Serum_114_-_Serum_114-DE-2008-YSP Sexy_Heroes_In_Transit-Its_All_In_The_Pants-(EP)-2008-RTB Sluts-Sexproitation_Is_Daily_Life-CDR-2008-COR Smartbomb-Diamond_Heist-2008-FNT Sondaschule-Herzlichen_Glueckwunsch-EP-DE-2008-SDR Sondaschule_-_Volle_Kanne-DE-2008-YSP Static_Thought-The_Motive_For_Movement-2008-pLAN9 Steady_State-Steady_State-2008-FNT Sybris-Into_The_Trees-2008-RTB The_Corps-Earlier_Offences-2008-SDR The_Game-Before_L.A.X-(Bootleg)-2008-H5N1x The_Guts-Let_It_Go-2008-FNT The_Sound_Of_Animals_Fighting-The_Ocean_and_The_Sun-2008 The_Sound_Of_Animals_Fighting-The_Ocean_and_The_Sun-2008-pLAN9 Three_To_Go-Furiosity-2008-FNT Toastersluts-Demo-2008-EXP Unwritten_Law-Live_And_Lawless-2008-FNT Useless_ID--The_Lost_Broken_Bones-CD-2008-PiT VA-Fuck_Capitalism_This_Is_Anti-G8_Compilation-CD-2008-COR VA-Kamikatze-Disco_Volante_Split_CD-2008-rH VA-Patterns-The_Falcon_Five-Split-(LP)-2008-FNT VA-Punk_Rock_Salutes_Metallica-(Retail)-2008-iNDULGE VA-Teenage_Bottlerocket-Broadway_Calls-Split-(7_Inch_Vinyl)-2008-FNT Valencia-We_All_Need_A_Reason_To_Believe-2008-FNT We_Are_Scientists-Impatience-(Promo_CDS)-2008-DV8 Wild_Billy_Childish_and_The_Musicians_Of_The_British_Empire-Thatchers_Children-Vinyl-2008-SDR |
Пользователь сказал спасибо: | iraklis (11.09.2008) |
18.09.2008, 19:52 | #318 |
tape
Репутация: 16
|
Re: Punk rock FTP
почитстил лейтест
Добавлено через 5 минут Abe_Vigoda-Skeleton-2008-DV8 Ambush-American_Monster-2008-FNT Bad_Luck_Charms-Bad_Luck_Charms-2008-FNT Bayside-Shudder-(Advance)-2008-FNT Bionic-Black_Blood-2007-HiBRiD Go_Crash_Audio-Dear_Song_In_My_Head-(Advance)-2008-FNT K-Jell-K-Jell-Promo_CDS-2008-PRS Last_Lights-Last_Lights-7_Inch-Vinyl-2008-KzT Lovvers_-_Think-Promo_Snippet-2008-YSP Maradona-Cool_Brag-(EP)-2008-EXP No_Relax-Indomabile-2CD-2008-FNT Pahat_Agentit-Kukkia_Poikkeaville-FI-2008-WAGNER Pinhead_Gunpowder-West_Side_Highway_VLS-2008-iTS Psychopunch--The_Pleasure_Kill_Reissue-2CD-2008-UBE Razorblade-Music_For_Maniacs-2008-SDR Razorblade-Trots_En_Vrij-EP-2005-SDR Rocket_From_The_Crypt-All_Systems_Go_III-2008-KzT Sakes_Alive-Act_I-2008-KzT Scream_Hello-Everything_Is_Always_Still_Happening-2008-RTB Sex_Pistols-Therell_Always_Be_an_England-DVD-2008-JUST Star_Fucking_Hipsters-Until_Were_Dead-2008-FNT Termites-Kicked_In_The_Teeth-2008-SDR The_Definitive_Measure-The_End_Of_The_Beginning-2008-FNT The_Druggers-Kindanshoujou-CDR-2008-COR The_Electric_City-Dark_Skies-(Promo_CDS)-2008-DV8 The_Lucky_Devils-Goin_Mad-2008-SDR The_Measure_(SA)-One_Chapter_In_The_Book-2008-FNT The_Riot_Before-Fists_Buried_In_Pockets-2008-FNT VA-Poison_Idea_and_Kill_Your_Idols_Split-Bipolar_Hardcore-VLS-Limited_Edition-2007-SDR VA_-_Das_ZK_Empfiehlt_Solidaritat-2008-YSP VA_-_Plastic_Bomb_64-MAG-2008-YSP Wild_Billy_Childish_And_The_MBEs-Thatchers_Children-2008-DV8 |
22.09.2008, 12:56 | #319 |
tape
Репутация: 16
|
Re: Punk rock FTP
A_Poetic_Yesterday-A_Little_South_Of_Zero-(Advance)-2008-FNT
Breathing_Fire-Years_Of_Lead-LP-2008-KzT Burn_Down_Rome-Devotion-(Advance)-2008-FNT Crime_In_Stereo-Selective_Wreckage-2008-FNT Die_Young-Through_The_Valleys_In_Between-2008-BUTT Energy-Invasions_Of_The_Mind-2008-FNT In_the_Face_of_War-We_Make_Our_Own_Luck-Australian_Retail-2008-GRAVEWISH I_Adapt-From_Town_To_Town-7_Inch-Vinyl-2007-KzT Jennifer_Gentle-Evanescent_Land_EP-(HR004)-Promo_CDM-2008-OBC Lovvers_-_Think-Promo_Snippet-2008-YSP Ruiner-I_Heard_These_Dudes_Are_Assholes-2008-FNT The_Ergs-Hindsight_Is_20-20_My_Friend-2008-FNT The_Gifthorse-The_Gifthorse-2008-GRAVEWISH The_King_Blues-Save_The_World_Get_The_Girl-(Promo)-2008-iFAG The_Pork_Dukes-All_The_Filth_With_Added_Filth-30th_Anniversary_Edition-(DAMGOOD279CD)-2007-pyt VA-Wild_News_To_Crash_Your_I-Pod-2007-hXc Wild_Billy_Childish_And_The_MBEs-Thatchers_Children-2008-DV8 A_Poetic_Yesterday-A_Little_South_Of_Zero-(Advance)-2008-FNT Breathing_Fire-Years_Of_Lead-LP-2008-KzT Burn_Down_Rome-Devotion-(Advance)-2008-FNT Crime_In_Stereo-Selective_Wreckage-2008-FNT Die_Young-Through_The_Valleys_In_Between-2008-BUTT Energy-Invasions_Of_The_Mind-2008-FNT In_the_Face_of_War-We_Make_Our_Own_Luck-Australian_Retail-2008-GRAVEWISH I_Adapt-From_Town_To_Town-7_Inch-Vinyl-2007-KzT Jennifer_Gentle-Evanescent_Land_EP-(HR004)-Promo_CDM-2008-OBC Lovvers_-_Think-Promo_Snippet-2008-YSP Ruiner-I_Heard_These_Dudes_Are_Assholes-2008-FNT The_Ergs-Hindsight_Is_20-20_My_Friend-2008-FNT The_Gifthorse-The_Gifthorse-2008-GRAVEWISH The_King_Blues-Save_The_World_Get_The_Girl-(Promo)-2008-iFAG The_Pork_Dukes-All_The_Filth_With_Added_Filth-30th_Anniversary_Edition-(DAMGOOD279CD)-2007-pyt VA-Wild_News_To_Crash_Your_I-Pod-2007-hXc Wild_Billy_Childish_And_The_MBEs-Thatchers_Children-2008-DV8 |
03.10.2008, 10:25 | #320 |
tape
Репутация: 16
|
Re: Punk rock FTP
Angercore-Time_Reveals-2008-JUST
Black_President-Black_President-2008-FNT Bromheads_Jacket-On_The_Brain-2008-DV8 Change_Of_Ideas-Were_In_This_Together-2008-gF Chris_Clavin-The_Roads_Dont_Lead_Home_(The_Roads_Lead_Everywhere)-(Vinyl)-2008-pLAN9 Consolation_Prizefighter-Share_Music-(Advance)-2008-PMS Die_Aerzte_-_Die_Beste_Band_Der_Welt_(Und_Zwar_Live)-DVD-DE-2008-MOD Energy-Race_The_Sun-(Repack)-7_Inch-Vinyl-2008-KzT F-Three--With_All_Our_Love-Rerip-Vinyl-2008-PiT Fireworks-Adventure_Nostalgia_And_Robbery-(Repack)-7_Inch-Vinyl-2008-KzT Fleet_Foxes-Fleet_Foxes-2CD-Limited_Edition-2008-JUST Go_Sell_Drugs-American_Handjob-2008-pLAN9 Idle_Hands-Idle_Hands-VLS-2008-SDR Ladyhawke-Ladyhawke-2008-DV8 Madison_Bloodbath-Gittin_Loose_With-2008-gF Mindsnare - Disturb The Hive Mr.Blue_-_Free_Born_Man-2008-YSP Punk_Blues_Review-Death_Or_Glory-2008-gF San_Andreas-Man_Or_Monster-(Advance)-2008-PMS Skalibans-Its_Voodoo-2008-PMS Skyline Collapse - Skyline Collapse Suicidal_Tendencies-How_Will_I_Laugh_Tomorrow-1988-ZADM Suicidal_Tendencies-Self_Titled_(25th_Anniversary_Edition)-Remastered-2008-hXc Take Warning - The Songs Of Operation Ivy The_Creepshow-Run_For_Your_Life-2008-RTB The_Gifthorse-The_Gifthorse-2008-GRAVEWISH The_Middle_Class-Out_Of_Vogue_The_Early_Material-2008-hXc The_Returners-Love_Like_Suicide-EP-2008-gF VA-Sick_Sick_Sick-CD-2008-gF VA_-_Das_ZK_Empfiehlt_Solidaritat-2008-YSP |
10.10.2008, 13:28 | #325 |
tape
Репутация: 16
|
Re: Punk rock FTP
AC-DC-Black_Ice-(Retail)-2008-WHiTEFiRE
Acid_Eater-Dirty-7inch-Vinyl-2008-COR An_Albatross-The_An_Albatross_Family_Album-2008-GRAVEWISH Aside_From_A_Day-Manufactured_Landscape-2008-r35 Beatsteaks-Launched-1999-IRC Bloodline_Ltd-This_Is_Our_Way-2008-hXc Disco_Volante-We_Are_Forever-(NER020)-2008-pyt Endwell-Revenge_Is_A_Healthy_Motive-(EP)-2008-SGV Ghostdown-Demo-2008-PMS Good_Reason-Age_Of_Reason-2008-gF Gutsnglory_-_Here_To_Stay-2008-YSP It_Prevails-The_Inspiration-2007-KzT Johnny_Cash-At_Folsom_Prison_(Legacy_Edition)-2CD-2008-ONe Johnny_Cash-Live_at_Osteraker_Prison-(Remastered)-2008-MTD Joy_Division-The_Marble_Index-Bootleg-2008-FWYH La_Quiete-La_Quiete-(7_Inch_Vinyl)-IT-2008-FNT lords-fuck_all_yall_mother_fuckers-2008-fnt MTG-The_Cop_Out-2008-hXc ONOFF-Dont_Take_Our_Word_For_It-2008-SDR Penetration-The_Best_of_Penetration-Remastered-2005-pyt Rejected_Youth-Rejected_Forever_-_Forever_Rejected-CDEP-Limited_Edition-2008-SDR Senses_Fail-Life_Is_Not_A_Waiting_Room-2008-FNT Strut_And_Shock-Damn_You_Devil_Let_Me_Go-2008-MTD Tessmarka-Tessmarka-(EP)-2008-FNT The_King_Blues-Save_The_World_Get_The_Girl-(Advance)-2008-DV8 The_Proto_K_Distillery-Tetrachord_For_Water_Troubles-2008-SDR The_Welch_Boys-Drinkin_Angry-2008-FNT Tranzmitors-Self_Titled-Vinyl-2008-hXc True_Colors-Perspective-7_Inch-Vinyl-2008-KzT VA-Big_Cheese_100-MAG-2008-gF VA-Shook_Ones-End_Of_A_Year-Split-(7_Inch_Vinyl)-2008-FNT va-small_brown_bike_and_cursive-2001-nuhs VA-Thursday-Envy-(Split)-2008-FNT va-yaphet_kotto_this_machine_kills_envy_split-2003-rh Varmints_and_Vagrants-Sunrise-2008-gF Young_At_Heart-Values-CDR-2008-UTP |
26.10.2008, 16:40 | #327 |
tape
Репутация: 16
|
Re: Punk rock FTP
Argetti-Flags_Of_Karma-2008-gF
Birth_Control-Going_To_Target-7Inch-Vinyl-2008-hXc Chaos_Days-Under_The_Weather-(EP)-2008-pLAN9 Como_Todo_Mundo_-_Pekoplena_Disko-BR-2007-FKK Crisis_What_Crisis-Bad_Toast-2008-gF D.O.A._-_Northern_Avenger-2008-YSP Dead_To_Me-Little_Brother-(EP)-2008-FNT Emery-While_Broken_Hearts_Prevail-(EP)-2008-RTB Emily_and_the_Orgasm_Addicts--Emily_and_the_Orgasm_Addicts-2008-OMA Failsafe-The_Truth_Is-2008-gF G.A.T.E.S-Devastation-Vinyl-2008-hXc Go_Sell_Drugs-American_Handjob-2008-pLAN9 Hanson_Brothers-Its_A_Living-2008-FNT History_of_Guns--Acedia-2008-OMA Home_Junior-Eternal_Play-(CDEP)-2008-WAGNER Isis-Holy_Tears_And_Not_In_Rivers_But_In_Drops-2008-hXc Joey_Cape_-_Bridge-2008-MST Juggling_Jugulars-Salute_No_One-LP-2008-COR Lonears-Un-X-Pressed-(EP)-2008-PMS Mischief_Brew-Jobs_In_Steeltown-(7_Inch_Vinyl)-2008-pLAN9 Mischief_Brew_and_Joe_Jack_Talcum-Photographs_From_The_Shoebox-(Vinyl)-2008-pLAN9 One_For_The_Team-Build_It_Up-(Advance)-2008-FNT Ouzo-Less_Bibles_More_Doubts-2008-gF P.J_and_Gaby-Alarm_Clocks_Kill_Dreams-2008-pLAN9 Pearls_for_Pigs-A_Pig_in_A_Poke-2008-gF Pixies-Doolittle-Ltd.Ed.-Remastered-2008-AMRC Pixies-Surfer_Rosa-Ltd.Ed.-Remastered-2007-AMRC Riverdales-Phase_3-(Remastered)-2008-FNT Riverdales-Storm_The_Streets-1997-rH Roll_The_Tanks-Suffer_City-2008-FNT Scream_Shout_Say_Nothing-The_Animals_Still_Run_This_City-2008-pLAN9 Skyline_Collapse-Skyline_Collapse-2008-pLAN9 Sugar_Puff_Demons-Falling_From_Grace-CD-2008-gF Surfin_Wombatz-Peter_Cushing-VLS-2008-gF Swingin_Utters-Hatest_Grits-2008-FNT Tat-Soho_Lights-(Advance)-2008-RVP The_Clash-Live_At_Shea_Stadium-2008-THEONLYBANDTHATMATTERS The_Ditch-The_Ditch-2008-pLAN9 The_Living_Daylights-Ways_To_Escape-2008-gF The_Night_Marchers--Mystery_Machine-VLS-2008-PiT The_Night_Marchers--Scene_Report-VLS-2008-PiT The_Night_Marchers--Whose_Lady_R_U-VLS-2008-PiT The_Sketch-Best_Kid_In_Town-CDEP-2008-gF The_Status-So_This_Is_Progress-2008-FNT The_Summer_Set-In_Color-(Advance_EP)-2008-FNT The_Tailgators-The_Tailgators-CD-2008-gF The_Vibrators-Pure_Mania_and_V2-2CD-2002-rH The_Wonder_Years-2007_Tour_EP-2007-RTB This_Is_The_Hospital-Daybreak-2007-FNT VA-All_Aboard_A_Tribute_To_Johnny_Cash-2008-FNT VA-All_Ages_A_Tribute_To_Kid_Dynamite-2008-FNT VA-Hey_Lover_and_Cafeteria_Dance_Fever-On_Safari_With_(Split)-7inch-Vinyl-2007-pLAN9 VA-Mans-Lion_of_the_North-Split-(CDR)-2008-FNT VA-Meny_Hellkin_and_The_Bunch-Split_CD-(Promo)-2008-pLAN9 VA-Zorch_Factor_Vol_2_and_3-2CD-2003-gF Wallride-Just_4_Fun-2008-gF You_Me_At_Six-Take_Off_Your_Colours-2008-KzT |
Пользователь сказал спасибо: | фык (28.11.2008) |
02.11.2008, 18:57 | #328 |
tape
Репутация: 16
|
Re: Punk rock FTP
Argy_Bargy-The_Likes_of_Us-2008-gF
A_Hero_A_Fake-Volatile-2008-FNT Bane-Reckoning_Day_(10th_Anniversary)-7inch-Ltd.Ed.-2008-UTP Daysworth_Fighting-Hold_Fast-2008-FNT Die_Profis-Neue_Sensationen_Und_Alte_Geheimnisse-DE-2008-SDR Farin_Urlaub_Racing_Team_-_Die_Wahrheit_Uebers_Luegen-2CD-DE-2008-MOD Hamiltons-Dont_Mess_Up-7_Inch-Vinyl-2008-TN Haunts-Haunts-(Advance)-2008-DV8 How_Dare_You_-_Comfort_Road-2008-FKK June_Paik-June_Paik-(10_Inch_Vinyl)-DE-2008-FNT Knife_Party-Just_Like_You_Only_Better-2008-404 Lower_Class_Brats-Demos_and_Outtakes_From_The_New_Seditionaries_Sessions-2008-SDR Minus_The_Bear-Acoustics-(EP)-2008-RTB No_Choice-Anaesthetize_This_Annihilate_That-2008-FNT Parts_And_Labor-Receivers-2008-FNT Pistola-The_Bleeder-(Advance)-2008-FNT Scream_Shout_Say_Nothing-Scream_Shout_Say_Nothing-(EP)-2006-pLAN9 Short_Attention-Clever_Maddening_and_Annoying-7_Inch-Vinyl-2008-TN Suburban_Legends-Lets_Be_Friends_and_Slay_The_Dragon_Together-2008-SSR Suis_La_Lune-Heir-CDEP-2008-hXc The_(International)_Noise_Conspiracy-The_Cross_Of_My_Calling-(Advance)-2008-RTB The_Artist_Life-Lets_Start_A_Riot-(EP)-2008- FNT The_Catalogs-The_Catalogs-7_Inch-Vinyl-2008-TN The_Glazers-The_Glazers-7_Inch-Vinyl-2008-TN The_Heartburns-Fixin_To_Die-PROPER-2008-r35 The_Nerve_Scheme-Self_Titled-EP-2008-gF The_Offspring-Live_Aux_Eurockeennes_De_Belfort-DVBS-2008-JUST The_Peabodys-The_Future_Will_Kill_You-(Bonus_Disc)-Vinyl-2008-TN The_Peabodys-The_Future_Will_Kill_You-7_Inch-Vinyl-2008-TN VA-Clothesline_From_Heaven-2006-gF Vitamin_X-Full_Scale_Assault-2008-hXc Wednesday_13-Fuck_It_Weil_Do_It_Live-2008-ARiGOLD White_Lung-Local_Garbage-7_Inch-Vinyl-2008-TN |
Похожие темы | ||||
Тема | Автор | Раздел | Ответов | Последнее сообщение |
The Casualties (USA, hardcore punk/punk rock) @ Бочка | fight | Events Archive | 4 | 13.04.2014 15:46 |
Wank For Peace (hardcore punk, FR), Foolish (skacore, FR), Charly Fiasco (punk rock, FR) @ Ledovij | zuzya | Events Archive | 8 | 26.07.2013 11:30 |
Nichiel’s (punk rock, FR), Justin(e) (punk rock, FR), Stringy!, Double Head Penguin, J.W.H. | Nook | Events Archive | 8 | 24.07.2012 14:44 |
Nina`school (punk rock, France), Wank For Peace (punk rock, France), Crackpot, Пустотрати | karapuzz | Events Archive | 10 | 18.07.2012 15:01 |
19/07/11 P.O.BOX (punk rock/ska punk, France), Nina`school (punk rock, France), Straytones @ Засідка | zuzya | Events Archive | 26 | 11.09.2011 15:26 |
|
|
Текущее время: 19:06. Часовой пояс GMT +3.
|
|||